C16H16ClNO2S — CID 26970345
(E)-2-(4-chlorophenyl)-N-(4-ethylphenyl)ethenesulfonamide (PubChem CID 26970345) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-N-(4-ethylphenyl)ethenesulfonamide.
| Compound Name | (E)-2-(4-chlorophenyl)-N-(4-ethylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 26970345 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-N-(4-ethylphenyl)ethenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClNO2S/c1-2-13-5-9-16(10-6-13)18-21(19,20)12-11-14-3-7-15(17)8-4-14/h3-12,18H,2H2,1H3/b12-11+ |
| InChIKey | FNLLGUMSOCQTDE-VAWYXSNFSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |