C13H12ClN3O3S — CID 8842478
N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-1H-pyrrole-2-carbohydrazide (PubChem CID 8842478) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 8842478 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)/C=C/c1ccc(Cl)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3S/c14-11-5-3-10(4-6-11)7-9-21(19,20)17-16-13(18)12-2-1-8-15-12/h1-9,15,17H,(H,16,18)/b9-7+ |
| InChIKey | DDUVUXHWTZMZTH-VQHVLOKHSA-N |
| XLogP | 1.90 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|