C20H28N2O3S — CID 26998920
N-(1-adamantylmethyl)-N-methyl-3-(methylsulfamoyl)benzamide (PubChem CID 26998920) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-methyl-3-(methylsulfamoyl)benzamide.
| Compound Name | N-(1-adamantylmethyl)-N-methyl-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26998920 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-(1-adamantylmethyl)-N-methyl-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)N(C)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H28N2O3S/c1-21-26(24,25)18-5-3-4-17(9-18)19(23)22(2)13-20-10-14-6-15(11-20)8-16(7-14)12-20/h3-5,9,14-16,21H,6-8,10-13H2,1-2H3 |
| InChIKey | UXQCSDWNHWLNKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |