C12H15ClN6 — CID 54215814
N'-[N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylcarbamimidoyl]-N,N-dimethylmethanimidamide (PubChem CID 54215814) has the molecular formula C12H15ClN6 and a molecular weight of 278.75 g/mol. Its IUPAC name is N'-[N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylcarbamimidoyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylcarbamimidoyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 54215814 |
| Molecular Formula | C12H15ClN6 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N'-[N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylcarbamimidoyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=N/C(=N\C#N)N(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H15ClN6/c1-18(2)9-17-12(16-8-14)19(3)7-10-4-5-11(13)15-6-10/h4-6,9H,7H2,1-3H3/b16-12+,17-9? |
| InChIKey | PZCKCEVLCAJXNZ-HZLPKMJASA-N |
| XLogP | 1.59 |
| TPSA | 67.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|