C12H14ClFN4 — CID 59202006
N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-(3-fluoropropyl)ethanimidamide (PubChem CID 59202006) has the molecular formula C12H14ClFN4 and a molecular weight of 268.72 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-(3-fluoropropyl)ethanimidamide.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-(3-fluoropropyl)ethanimidamide |
|---|---|
| PubChem CID | 59202006 |
| Molecular Formula | C12H14ClFN4 |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-(3-fluoropropyl)ethanimidamide |
| SMILES | C/C(=N\C#N)N(CCCF)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClFN4/c1-10(17-9-15)18(6-2-5-14)8-11-3-4-12(13)16-7-11/h3-4,7H,2,5-6,8H2,1H3/b17-10+ |
| InChIKey | GWNXIDZAVAAXIO-LICLKQGHSA-N |
| XLogP | 2.80 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|