C15H19ClN6O2S — CID 88537324
N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide;(2Z)-2-(nitromethylidene)-1,3-thiazinane (PubChem CID 88537324) has the molecular formula C15H19ClN6O2S and a molecular weight of 382.88 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide;(2Z)-2-(nitromethylidene)-1,3-thiazinane.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide;(2Z)-2-(nitromethylidene)-1,3-thiazinane |
|---|---|
| PubChem CID | 88537324 |
| Molecular Formula | C15H19ClN6O2S |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide;(2Z)-2-(nitromethylidene)-1,3-thiazinane |
| SMILES | C/C(=N\C#N)N(C)Cc1ccc(Cl)nc1.O=[N+]([O-])/C=C1/NCCCS1 |
| InChI | InChI=1S/C10H11ClN4.C5H8N2O2S/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9;8-7(9)4-5-6-2-1-3-10-5/h3-5H,6H2,1-2H3;4,6H,1-3H2/b14-8+;5-4- |
| InChIKey | RCQWCYOMWDQSEV-ZPLWZGFLSA-N |
| XLogP | 2.85 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|