C12H15ClN4O2 — CID 172777210
acetic acid;N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide (PubChem CID 172777210) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is acetic acid;N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide.
| Compound Name | acetic acid;N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide |
|---|---|
| PubChem CID | 172777210 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | acetic acid;N-[(6-chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide |
| SMILES | C/C(=N\C#N)N(C)Cc1ccc(Cl)nc1.CC(=O)O |
| InChI | InChI=1S/C10H11ClN4.C2H4O2/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9;1-2(3)4/h3-5H,6H2,1-2H3;1H3,(H,3,4)/b14-8+; |
| InChIKey | NTNKEDUNHFPGOX-XHIXCECLSA-N |
| XLogP | 2.16 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|