C14H12ClF3N4O2 — CID 123839062
[[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2,2,2-trifluoroethylidene]amino] 1-cyanocyclopropane-1-carboxylate (PubChem CID 123839062) has the molecular formula C14H12ClF3N4O2 and a molecular weight of 360.72 g/mol. Its IUPAC name is [[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2,2,2-trifluoroethylidene]amino] 1-cyanocyclopropane-1-carboxylate.
| Compound Name | [[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2,2,2-trifluoroethylidene]amino] 1-cyanocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123839062 |
| Molecular Formula | C14H12ClF3N4O2 |
| Molecular Weight | 360.72 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [[1-[(6-chloro-3-pyridinyl)methyl-methylamino]-2,2,2-trifluoroethylidene]amino] 1-cyanocyclopropane-1-carboxylate |
| SMILES | CN(Cc1ccc(Cl)nc1)C(=NOC(=O)C1(C#N)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H12ClF3N4O2/c1-22(7-9-2-3-10(15)20-6-9)11(14(16,17)18)21-24-12(23)13(8-19)4-5-13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | WBXRIYXEQUUKKJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|