C12H13F3N4 — CID 134243455
N'-cyano-N-ethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]ethanimidamide (PubChem CID 134243455) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is N'-cyano-N-ethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]ethanimidamide.
| Compound Name | N'-cyano-N-ethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 134243455 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N'-cyano-N-ethyl-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]ethanimidamide |
| SMILES | CCN(Cc1ccc(C(F)(F)F)nc1)/C(C)=N/C#N |
| InChI | InChI=1S/C12H13F3N4/c1-3-19(9(2)18-8-16)7-10-4-5-11(17-6-10)12(13,14)15/h4-6H,3,7H2,1-2H3/b18-9+ |
| InChIKey | KVAGBHOFWBXKGF-GIJQJNRQSA-N |
| XLogP | 2.82 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|