C23H31N3O2 — CID 138505615
4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(E)-non-2-enoic acid (PubChem CID 138505615) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(E)-non-2-enoic acid.
| Compound Name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(E)-non-2-enoic acid |
|---|---|
| PubChem CID | 138505615 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(E)-non-2-enoic acid |
| SMILES | CCCCCC/C=C/C(=O)O.Cc1cc(C2CC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3.C9H16O2/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12;1-2-3-4-5-6-7-8-9(10)11/h2-6,9,11H,7-8H2,1H3,(H,15,16,17);7-8H,2-6H2,1H3,(H,10,11)/b;8-7+ |
| InChIKey | JTWSEPSMXLHUGV-ILHSMLOTSA-N |
| XLogP | 6.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|