C14H11N3 — CID 142647855
4-cycloprop-2-yn-1-yl-6-methyl-N-phenylpyrimidin-2-amine (PubChem CID 142647855) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-cycloprop-2-yn-1-yl-6-methyl-N-phenylpyrimidin-2-amine.
| Compound Name | 4-cycloprop-2-yn-1-yl-6-methyl-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 142647855 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-cycloprop-2-yn-1-yl-6-methyl-N-phenylpyrimidin-2-amine |
| SMILES | Cc1cc(C2C#C2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H11N3/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h2-6,9,11H,1H3,(H,15,16,17) |
| InChIKey | VTWMHFCUVLOKEP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|