C12H10F3N3 — CID 20585928
4-methyl-N-phenyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 20585928) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-methyl-N-phenyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-N-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 20585928 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-methyl-N-phenyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(C(F)(F)F)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H10F3N3/c1-8-7-10(12(13,14)15)18-11(16-8)17-9-5-3-2-4-6-9/h2-7H,1H3,(H,16,17,18) |
| InChIKey | DNRMOPZIWXICON-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |