C9H10F3N3O2 — CID 122049909
(2R)-2-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]amino]propanoic acid (PubChem CID 122049909) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is (2R)-2-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]amino]propanoic acid.
| Compound Name | (2R)-2-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 122049909 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (2R)-2-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]amino]propanoic acid |
| SMILES | Cc1cc(C(F)(F)F)nc(N[C@H](C)C(=O)O)n1 |
| InChI | InChI=1S/C9H10F3N3O2/c1-4-3-6(9(10,11)12)15-8(13-4)14-5(2)7(16)17/h3,5H,1-2H3,(H,16,17)(H,13,14,15)/t5-/m1/s1 |
| InChIKey | NJGQMMRVZDYJGG-RXMQYKEDSA-N |
| XLogP | 1.69 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |