C7H7F2N3O2 — CID 6935115
(2R)-2-[(4,6-difluoropyrimidin-2-yl)amino]propanoic acid (PubChem CID 6935115) has the molecular formula C7H7F2N3O2 and a molecular weight of 203.15 g/mol. Its IUPAC name is (2R)-2-[(4,6-difluoropyrimidin-2-yl)amino]propanoic acid.
| Compound Name | (2R)-2-[(4,6-difluoropyrimidin-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 6935115 |
| Molecular Formula | C7H7F2N3O2 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (2R)-2-[(4,6-difluoropyrimidin-2-yl)amino]propanoic acid |
| SMILES | C[C@@H](Nc1nc(F)cc(F)n1)C(=O)O |
| InChI | InChI=1S/C7H7F2N3O2/c1-3(6(13)14)10-7-11-4(8)2-5(9)12-7/h2-3H,1H3,(H,13,14)(H,10,11,12)/t3-/m1/s1 |
| InChIKey | NUWFTGRSJRNEAG-GSVOUGTGSA-N |
| XLogP | 0.64 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |