C13H12FN3O2 — CID 116975229
2-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]propanoic acid (PubChem CID 116975229) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]propanoic acid.
| Compound Name | 2-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 116975229 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)pyrimidin-2-yl]amino]propanoic acid |
| SMILES | CC(Nc1ncc(-c2ccccc2F)cn1)C(=O)O |
| InChI | InChI=1S/C13H12FN3O2/c1-8(12(18)19)17-13-15-6-9(7-16-13)10-4-2-3-5-11(10)14/h2-8H,1H3,(H,18,19)(H,15,16,17) |
| InChIKey | KBPINVWMVSLACZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |