C11H14Br2N4O2 — CID 141277230
1-N'-[(4,6-dibromo-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 141277230) has the molecular formula C11H14Br2N4O2 and a molecular weight of 394.07 g/mol. Its IUPAC name is 1-N'-[(4,6-dibromo-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[(4,6-dibromo-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 141277230 |
| Molecular Formula | C11H14Br2N4O2 |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 1-N'-[(4,6-dibromo-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CCN(Cc1cnc(Br)cc1Br)C(=C[N+](=O)[O-])NC |
| InChI | InChI=1S/C11H14Br2N4O2/c1-3-16(11(14-2)7-17(18)19)6-8-5-15-10(13)4-9(8)12/h4-5,7,14H,3,6H2,1-2H3 |
| InChIKey | STUMORZMKYCUST-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|