C11H14ClN3O2 — CID 59896589
1-N'-[(4-chlorophenyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine (PubChem CID 59896589) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is 1-N'-[(4-chlorophenyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[(4-chlorophenyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 59896589 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-N'-[(4-chlorophenyl)methyl]-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
| SMILES | CNC(=C[N+](=O)[O-])N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-13-11(8-15(16)17)14(2)7-9-3-5-10(12)6-4-9/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | KCQOIYGMBPRSKB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|