About [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene
[(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene (PubChem CID 88611908) has the molecular formula C9H12BrN3O2S
and a molecular weight of 306.19 g/mol. Its IUPAC name is [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene.
Molecular Properties
| Compound Name | [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene |
| PubChem CID | 88611908 |
| Molecular Formula | C9H12BrN3O2S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene |
| SMILES | C=C[N+](=O)[O-].SCNCc1ccc(Br)nc1 |
| InChI | InChI=1S/C7H9BrN2S.C2H3NO2/c8-7-2-1-6(4-10-7)3-9-5-11;1-2-3(4)5/h1-2,4,9,11H,3,5H2;2H,1H2 |
| InChIKey | SYCOEKIEDMKFHQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene?
The IUPAC name of [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene (CID 88611908) is [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene.
What is the SMILES notation for [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene?
The canonical SMILES for [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene is C=C[N+](=O)[O-].SCNCc1ccc(Br)nc1.
What is the InChIKey of [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene?
The InChIKey is SYCOEKIEDMKFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2S.C2H3NO2/c8-7-2-1-6(4-10-7)3-9-5-11;1-2-3(4)5/h1-2,4,9,11H,3,5H2;2H,1H2.
What are the key properties of [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene?
[(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene has a molecular weight of 306.19 g/mol, XLogP of 2.23, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-bromo-3-pyridinyl)methylamino]methanethiol;1-nitroethene is sourced from PubChem (CID 88611908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).