C12H15ClN6O2 — CID 135686632
(NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-prop-2-enyl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135686632) has the molecular formula C12H15ClN6O2 and a molecular weight of 310.75 g/mol. Its IUPAC name is (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-prop-2-enyl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-prop-2-enyl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135686632 |
| Molecular Formula | C12H15ClN6O2 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-prop-2-enyl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | C=CCN1CN/C(=N/[N+](=O)[O-])N(Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C12H15ClN6O2/c1-2-5-17-8-15-12(16-19(20)21)18(9-17)7-10-3-4-11(13)14-6-10/h2-4,6H,1,5,7-9H2,(H,15,16) |
| InChIKey | IMMJXIKZZZBNBA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|