C17H19N5O2 — CID 135411319
(NZ)-N-(1,5-dibenzyl-1,3,5-triazinan-2-ylidene)nitramide (PubChem CID 135411319) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (NZ)-N-(1,5-dibenzyl-1,3,5-triazinan-2-ylidene)nitramide.
| Compound Name | (NZ)-N-(1,5-dibenzyl-1,3,5-triazinan-2-ylidene)nitramide |
|---|---|
| PubChem CID | 135411319 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (NZ)-N-(1,5-dibenzyl-1,3,5-triazinan-2-ylidene)nitramide |
| SMILES | O=[N+]([O-])/N=C1/NCN(Cc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O2/c23-22(24)19-17-18-13-20(11-15-7-3-1-4-8-15)14-21(17)12-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) |
| InChIKey | WYCSQVFVBVTWRQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|