C10H13N5O2 — CID 135727121
(NZ)-N-(1-methyl-5-phenyl-1,3,5-triazinan-2-ylidene)nitramide (PubChem CID 135727121) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is (NZ)-N-(1-methyl-5-phenyl-1,3,5-triazinan-2-ylidene)nitramide.
| Compound Name | (NZ)-N-(1-methyl-5-phenyl-1,3,5-triazinan-2-ylidene)nitramide |
|---|---|
| PubChem CID | 135727121 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (NZ)-N-(1-methyl-5-phenyl-1,3,5-triazinan-2-ylidene)nitramide |
| SMILES | CN1CN(c2ccccc2)CN/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N5O2/c1-13-8-14(9-5-3-2-4-6-9)7-11-10(13)12-15(16)17/h2-6H,7-8H2,1H3,(H,11,12) |
| InChIKey | YQDWAIGOFXLMHU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|