C16H21Cl2N11O4S2 — CID 172949263
(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide;(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 172949263) has the molecular formula C16H21Cl2N11O4S2 and a molecular weight of 566.46 g/mol. Its IUPAC name is (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide;(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide;(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 172949263 |
| Molecular Formula | C16H21Cl2N11O4S2 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide;(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | CN1CN(C)/C(=N\[N+](=O)[O-])N(Cc2cnc(Cl)s2)C1.O=[N+]([O-])/N=C1\NCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H13ClN6O2S.C7H8ClN5O2S/c1-13-5-14(2)9(12-16(17)18)15(6-13)4-7-3-11-8(10)19-7;8-6-10-3-5(16-6)4-12-2-1-9-7(12)11-13(14)15/h3H,4-6H2,1-2H3;3H,1-2,4H2,(H,9,11)/b12-9+; |
| InChIKey | CQKTVZJGWMBOJZ-NBYYMMLRSA-N |
| XLogP | 1.69 |
| TPSA | 161.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|