C7H8ClN5O3S — CID 136985349
N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 136985349) has the molecular formula C7H8ClN5O3S and a molecular weight of 277.69 g/mol. Its IUPAC name is N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 136985349 |
| Molecular Formula | C7H8ClN5O3S |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1NCOCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H8ClN5O3S/c8-6-9-1-5(17-6)2-12-4-16-3-10-7(12)11-13(14)15/h1H,2-4H2,(H,10,11) |
| InChIKey | LOXCNVOJGRNBFX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|