C11H15ClN4O3S — CID 148723683
(4E)-3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-4-(1-nitropropylidene)-1,3,5-oxadiazinane (PubChem CID 148723683) has the molecular formula C11H15ClN4O3S and a molecular weight of 318.79 g/mol. Its IUPAC name is (4E)-3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-4-(1-nitropropylidene)-1,3,5-oxadiazinane.
| Compound Name | (4E)-3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-4-(1-nitropropylidene)-1,3,5-oxadiazinane |
|---|---|
| PubChem CID | 148723683 |
| Molecular Formula | C11H15ClN4O3S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (4E)-3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-4-(1-nitropropylidene)-1,3,5-oxadiazinane |
| SMILES | CC/C(=C1/N(C)COCN1Cc1cnc(Cl)s1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H15ClN4O3S/c1-3-9(16(17)18)10-14(2)6-19-7-15(10)5-8-4-13-11(12)20-8/h4H,3,5-7H2,1-2H3/b10-9+ |
| InChIKey | NZOXKSVPTMRCMH-MDZDMXLPSA-N |
| XLogP | 2.33 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|