C24H27ClN8O8S2 — CID 56963350
(NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide;2-methoxy-N-[4-(methylcarbamoylamino)phenyl]sulfonylbenzamide (PubChem CID 56963350) has the molecular formula C24H27ClN8O8S2 and a molecular weight of 655.12 g/mol. Its IUPAC name is (NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide;2-methoxy-N-[4-(methylcarbamoylamino)phenyl]sulfonylbenzamide.
| Compound Name | (NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide;2-methoxy-N-[4-(methylcarbamoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 56963350 |
| Molecular Formula | C24H27ClN8O8S2 |
| Molecular Weight | 655.12 g/mol |
| Exact Mass | 654.11 |
| IUPAC Name | (NZ)-N-[3-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-ylidene]nitramide;2-methoxy-N-[4-(methylcarbamoylamino)phenyl]sulfonylbenzamide |
| SMILES | CN1COCN(Cc2cnc(Cl)s2)/C1=N\[N+](=O)[O-].CNC(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C16H17N3O5S.C8H10ClN5O3S/c1-17-16(21)18-11-7-9-12(10-8-11)25(22,23)19-15(20)13-5-3-4-6-14(13)24-2;1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h3-10H,1-2H3,(H,19,20)(H2,17,18,21);2H,3-5H2,1H3/b;11-8- |
| InChIKey | CNULPHUCBFCEQY-BOHXSWMZSA-N |
| XLogP | 2.59 |
| TPSA | 197.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|