C8H11ClN6O2S — CID 135778494
(NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135778494) has the molecular formula C8H11ClN6O2S and a molecular weight of 290.74 g/mol. Its IUPAC name is (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135778494 |
| Molecular Formula | C8H11ClN6O2S |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CN1CN/C(=N/[N+](=O)[O-])N(Cc2cnc(Cl)s2)C1 |
| InChI | InChI=1S/C8H11ClN6O2S/c1-13-4-11-8(12-15(16)17)14(5-13)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3,(H,11,12) |
| InChIKey | PUDCRNLWGSECKX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|