C8H10ClN5O3S — CID 139664871
N-[3-[1-(2-chloro-1,3-thiazol-5-yl)ethyl]-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 139664871) has the molecular formula C8H10ClN5O3S and a molecular weight of 291.72 g/mol. Its IUPAC name is N-[3-[1-(2-chloro-1,3-thiazol-5-yl)ethyl]-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | N-[3-[1-(2-chloro-1,3-thiazol-5-yl)ethyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 139664871 |
| Molecular Formula | C8H10ClN5O3S |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | N-[3-[1-(2-chloro-1,3-thiazol-5-yl)ethyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CC(c1cnc(Cl)s1)N1COCNC1=N[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN5O3S/c1-5(6-2-10-7(9)18-6)13-4-17-3-11-8(13)12-14(15)16/h2,5H,3-4H2,1H3,(H,11,12) |
| InChIKey | JRETXPHGNMESHW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|