C12H17ClN6O2 — CID 135778493
(NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-propan-2-yl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135778493) has the molecular formula C12H17ClN6O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-propan-2-yl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-propan-2-yl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135778493 |
| Molecular Formula | C12H17ClN6O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (NZ)-N-[1-[(6-chloro-3-pyridinyl)methyl]-5-propan-2-yl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CC(C)N1CN/C(=N/[N+](=O)[O-])N(Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C12H17ClN6O2/c1-9(2)18-7-15-12(16-19(20)21)17(8-18)6-10-3-4-11(13)14-5-10/h3-5,9H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | MLTJSOKVOGKDOW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|