C8H10ClN5O2S — CID 135852985
(NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazinan-2-ylidene]nitramide (PubChem CID 135852985) has the molecular formula C8H10ClN5O2S and a molecular weight of 275.72 g/mol. Its IUPAC name is (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135852985 |
| Molecular Formula | C8H10ClN5O2S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazinan-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])/N=C1/NCCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C8H10ClN5O2S/c9-7-11-4-6(17-7)5-13-3-1-2-10-8(13)12-14(15)16/h4H,1-3,5H2,(H,10,12) |
| InChIKey | ZMVSOXBOHGLVSJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|