C8H12ClN3S — CID 130856912
2-chloro-5-(diazinan-1-ylmethyl)-1,3-thiazole (PubChem CID 130856912) has the molecular formula C8H12ClN3S and a molecular weight of 217.72 g/mol. Its IUPAC name is 2-chloro-5-(diazinan-1-ylmethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(diazinan-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130856912 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-chloro-5-(diazinan-1-ylmethyl)-1,3-thiazole |
| SMILES | Clc1ncc(CN2CCCCN2)s1 |
| InChI | InChI=1S/C8H12ClN3S/c9-8-10-5-7(13-8)6-12-4-2-1-3-11-12/h5,11H,1-4,6H2 |
| InChIKey | BFFVNKWWERXPTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |