About 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide
2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide (PubChem CID 131123308) has the molecular formula C6H7ClN2O2S2
and a molecular weight of 238.72 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide.
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide (CID 131123308) is 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide is O=S1(=O)CCN1Cc1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide?
The InChIKey is QBUKCXSBADJDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S2/c7-6-8-3-5(12-6)4-9-1-2-13(9,10)11/h3H,1-2,4H2.
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide?
2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide has a molecular weight of 238.72 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)methyl]thiazetidine 1,1-dioxide is sourced from PubChem (CID 131123308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).