C10H11ClN2O2S — CID 79765235
1-[(2-chloro-1,3-thiazol-5-yl)methyl]azepane-2,7-dione (PubChem CID 79765235) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]azepane-2,7-dione.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]azepane-2,7-dione |
|---|---|
| PubChem CID | 79765235 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]azepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H11ClN2O2S/c11-10-12-5-7(16-10)6-13-8(14)3-1-2-4-9(13)15/h5H,1-4,6H2 |
| InChIKey | SEZNFLKJQHOHAN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|