C7H12N4O — CID 131198300
5-(diazinan-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 131198300) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(diazinan-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diazinan-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131198300 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-(diazinan-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1noc(CN2CCCCN2)n1 |
| InChI | InChI=1S/C7H12N4O/c1-2-4-11(9-3-1)5-7-8-6-10-12-7/h6,9H,1-5H2 |
| InChIKey | POQVKMOYSBQJOS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |