C9H13N5O3S2 — CID 20643182
(NE)-N-[3-methyl-5-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide (PubChem CID 20643182) has the molecular formula C9H13N5O3S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is (NE)-N-[3-methyl-5-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide.
| Compound Name | (NE)-N-[3-methyl-5-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 20643182 |
| Molecular Formula | C9H13N5O3S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (NE)-N-[3-methyl-5-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]-1,3,5-oxadiazinan-4-ylidene]nitramide |
| SMILES | CSc1ncc(CN2COCN(C)/C2=N\[N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H13N5O3S2/c1-12-5-17-6-13(8(12)11-14(15)16)4-7-3-10-9(18-2)19-7/h3H,4-6H2,1-2H3/b11-8+ |
| InChIKey | PULHNSDVEHPPHK-DHZHZOJOSA-N |
| XLogP | 1.09 |
| TPSA | 84.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|