C15H22ClN5O2S — CID 14014173
2-chloro-5-[[6-(2-methylbutan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-c]pyrimidin-1-yl]methyl]-1,3-thiazole (PubChem CID 14014173) has the molecular formula C15H22ClN5O2S and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-chloro-5-[[6-(2-methylbutan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-c]pyrimidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[[6-(2-methylbutan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-c]pyrimidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 14014173 |
| Molecular Formula | C15H22ClN5O2S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-chloro-5-[[6-(2-methylbutan-2-yl)-8-nitro-2,3,5,7-tetrahydroimidazo[1,2-c]pyrimidin-1-yl]methyl]-1,3-thiazole |
| SMILES | CCC(C)(C)N1CC([N+](=O)[O-])=C2N(Cc3cnc(Cl)s3)CCN2C1 |
| InChI | InChI=1S/C15H22ClN5O2S/c1-4-15(2,3)20-9-12(21(22)23)13-18(5-6-19(13)10-20)8-11-7-17-14(16)24-11/h7H,4-6,8-10H2,1-3H3 |
| InChIKey | WSRSRUYJUAIMCA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|