C17H17ClN4O3S — CID 71481358
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-5-ol (PubChem CID 71481358) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-5-ol.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-5-ol |
|---|---|
| PubChem CID | 71481358 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-nitro-7-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridin-5-ol |
| SMILES | O=[N+]([O-])C1=C2N(Cc3cnc(Cl)s3)CCN2C(O)CC1c1ccccc1 |
| InChI | InChI=1S/C17H17ClN4O3S/c18-17-19-9-12(26-17)10-20-6-7-21-14(23)8-13(11-4-2-1-3-5-11)15(16(20)21)22(24)25/h1-5,9,13-14,23H,6-8,10H2 |
| InChIKey | JBJGRZPLBBCJOA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|