C12H12ClN4O2S+ — CID 175050865
2-chloro-5-[(3-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-1-yl)methyl]-1,3-thiazole (PubChem CID 175050865) has the molecular formula C12H12ClN4O2S+ and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-chloro-5-[(3-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-1-yl)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[(3-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 175050865 |
| Molecular Formula | C12H12ClN4O2S+ |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-chloro-5-[(3-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-1-yl)methyl]-1,3-thiazole |
| SMILES | CC1CN(Cc2cnc(Cl)s2)c2c([N+](=O)[O-])ccc[n+]21 |
| InChI | InChI=1S/C12H12ClN4O2S/c1-8-6-15(7-9-5-14-12(13)20-9)11-10(17(18)19)3-2-4-16(8)11/h2-5,8H,6-7H2,1H3/q+1 |
| InChIKey | ZLAWBJYQHOYWML-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|