C9H7ClN4O4S — CID 79765240
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione (PubChem CID 79765240) has the molecular formula C9H7ClN4O4S and a molecular weight of 302.70 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79765240 |
| Molecular Formula | C9H7ClN4O4S |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methyl-5-nitropyrimidine-2,4-dione |
| SMILES | Cn1cc([N+](=O)[O-])c(=O)n(Cc2cnc(Cl)s2)c1=O |
| InChI | InChI=1S/C9H7ClN4O4S/c1-12-4-6(14(17)18)7(15)13(9(12)16)3-5-2-11-8(10)19-5/h2,4H,3H2,1H3 |
| InChIKey | AWXBKFZYGIUETK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|