C11H12N6O4 — CID 103057351
1-methyl-3-[[5-(methylamino)pyrazin-2-yl]methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 103057351) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-methyl-3-[[5-(methylamino)pyrazin-2-yl]methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-[[5-(methylamino)pyrazin-2-yl]methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103057351 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-methyl-3-[[5-(methylamino)pyrazin-2-yl]methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | CNc1cnc(Cn2c(=O)c([N+](=O)[O-])cn(C)c2=O)cn1 |
| InChI | InChI=1S/C11H12N6O4/c1-12-9-4-13-7(3-14-9)5-16-10(18)8(17(20)21)6-15(2)11(16)19/h3-4,6H,5H2,1-2H3,(H,12,14) |
| InChIKey | XKRVWWZVIYGTKB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|