C12H11ClN4O3S — CID 155666837
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-5-one (PubChem CID 155666837) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 155666837 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-8-nitro-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| SMILES | CC1Cn2c(c([N+](=O)[O-])ccc2=O)N1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C12H11ClN4O3S/c1-7-5-16-10(18)3-2-9(17(19)20)11(16)15(7)6-8-4-14-12(13)21-8/h2-4,7H,5-6H2,1H3 |
| InChIKey | YTBMKEPSGMBLEY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|