C12H15ClN4O2S — CID 44556633
2-chloro-5-[[(2E)-2-(nitromethylidene)-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]methyl]-1,3-thiazole (PubChem CID 44556633) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is 2-chloro-5-[[(2E)-2-(nitromethylidene)-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[[(2E)-2-(nitromethylidene)-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 44556633 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-chloro-5-[[(2E)-2-(nitromethylidene)-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]methyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])/C=C1\NC2CCCCC2N1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C12H15ClN4O2S/c13-12-14-5-8(20-12)6-16-10-4-2-1-3-9(10)15-11(16)7-17(18)19/h5,7,9-10,15H,1-4,6H2/b11-7+ |
| InChIKey | DLZQEPQTBKDLNJ-YRNVUSSQSA-N |
| XLogP | 2.59 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|