C13H13ClN4O3S — CID 155666820
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-methyl-9-nitro-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-6-one (PubChem CID 155666820) has the molecular formula C13H13ClN4O3S and a molecular weight of 340.79 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-methyl-9-nitro-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-6-one.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-methyl-9-nitro-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 155666820 |
| Molecular Formula | C13H13ClN4O3S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-8-methyl-9-nitro-3,4-dihydro-2H-pyrido[1,2-a]pyrimidin-6-one |
| SMILES | Cc1cc(=O)n2c(c1[N+](=O)[O-])N(Cc1cnc(Cl)s1)CCC2 |
| InChI | InChI=1S/C13H13ClN4O3S/c1-8-5-10(19)17-4-2-3-16(12(17)11(8)18(20)21)7-9-6-15-13(14)22-9/h5-6H,2-4,7H2,1H3 |
| InChIKey | JMMVVFGXRYOVFP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|