C12H13ClN4O2S — CID 141449787
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N,4,6-trimethyl-3-nitropyridin-2-amine (PubChem CID 141449787) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N,4,6-trimethyl-3-nitropyridin-2-amine.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N,4,6-trimethyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 141449787 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N,4,6-trimethyl-3-nitropyridin-2-amine |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(N(C)Cc2cnc(Cl)s2)n1 |
| InChI | InChI=1S/C12H13ClN4O2S/c1-7-4-8(2)15-11(10(7)17(18)19)16(3)6-9-5-14-12(13)20-9/h4-5H,6H2,1-3H3 |
| InChIKey | XGRHBRMKWJUPRK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|