C13H11ClN4O2S2 — CID 46236537
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(3-nitrophenyl)-1,3-thiazolidin-2-imine (PubChem CID 46236537) has the molecular formula C13H11ClN4O2S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(3-nitrophenyl)-1,3-thiazolidin-2-imine.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(3-nitrophenyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 46236537 |
| Molecular Formula | C13H11ClN4O2S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(3-nitrophenyl)-1,3-thiazolidin-2-imine |
| SMILES | O=[N+]([O-])c1cccc(/N=C2\SCCN2Cc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C13H11ClN4O2S2/c14-12-15-7-11(22-12)8-17-4-5-21-13(17)16-9-2-1-3-10(6-9)18(19)20/h1-3,6-7H,4-5,8H2/b16-13- |
| InChIKey | SAEPOFZMQITHEY-SSZFMOIBSA-N |
| XLogP | 3.94 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|