C7H8ClN3S2 — CID 10198562
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 10198562) has the molecular formula C7H8ClN3S2 and a molecular weight of 233.75 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 10198562 |
| Molecular Formula | C7H8ClN3S2 |
| Molecular Weight | 233.75 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H8ClN3S2/c8-6-10-3-5(13-6)4-11-1-2-12-7(11)9/h3,9H,1-2,4H2/b9-7- |
| InChIKey | WFGLBBZHLLVCNI-CLFYSBASSA-N |
| XLogP | 2.28 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|