C15H14ClN3S — CID 24788545
N-(4-chlorophenyl)-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-2-imine (PubChem CID 24788545) has the molecular formula C15H14ClN3S and a molecular weight of 303.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-2-imine.
| Compound Name | N-(4-chlorophenyl)-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 24788545 |
| Molecular Formula | C15H14ClN3S |
| Molecular Weight | 303.82 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-(4-chlorophenyl)-3-(pyridin-2-ylmethyl)-1,3-thiazolidin-2-imine |
| SMILES | Clc1ccc(/N=C2\SCCN2Cc2ccccn2)cc1 |
| InChI | InChI=1S/C15H14ClN3S/c16-12-4-6-13(7-5-12)18-15-19(9-10-20-15)11-14-3-1-2-8-17-14/h1-8H,9-11H2/b18-15- |
| InChIKey | SOUIGZGEBBMOIV-SDXDJHTJSA-N |
| XLogP | 3.97 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|