C15H21N5O3 — CID 139743739
N-[5-benzyl-1-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 139743739) has the molecular formula C15H21N5O3 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[5-benzyl-1-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | N-[5-benzyl-1-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139743739 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[5-benzyl-1-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1NCN(Cc2ccccc2)CN1CC1CCOC1 |
| InChI | InChI=1S/C15H21N5O3/c21-20(22)17-15-16-11-18(8-13-4-2-1-3-5-13)12-19(15)9-14-6-7-23-10-14/h1-5,14H,6-12H2,(H,16,17) |
| InChIKey | RBGAHNAKXPBFBL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|