C16H19BrN4O5 — CID 139678340
(2-bromophenyl)methyl 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate (PubChem CID 139678340) has the molecular formula C16H19BrN4O5 and a molecular weight of 427.26 g/mol. Its IUPAC name is (2-bromophenyl)methyl 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate.
| Compound Name | (2-bromophenyl)methyl 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 139678340 |
| Molecular Formula | C16H19BrN4O5 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (2-bromophenyl)methyl 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1Br)N1CCN(CC2CCOC2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C16H19BrN4O5/c17-14-4-2-1-3-13(14)11-26-16(22)20-7-6-19(15(20)18-21(23)24)9-12-5-8-25-10-12/h1-4,12H,5-11H2 |
| InChIKey | LIXHYHJOTPCKTI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|