C16H18Cl2N4O3 — CID 139678615
N-[1-[2-(3,4-dichlorophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide (PubChem CID 139678615) has the molecular formula C16H18Cl2N4O3 and a molecular weight of 385.25 g/mol. Its IUPAC name is N-[1-[2-(3,4-dichlorophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-[2-(3,4-dichlorophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678615 |
| Molecular Formula | C16H18Cl2N4O3 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[1-[2-(3,4-dichlorophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1N(C=Cc2ccc(Cl)c(Cl)c2)CCN1CC1CCOC1 |
| InChI | InChI=1S/C16H18Cl2N4O3/c17-14-2-1-12(9-15(14)18)3-5-20-6-7-21(16(20)19-22(23)24)10-13-4-8-25-11-13/h1-3,5,9,13H,4,6-8,10-11H2 |
| InChIKey | DEGATYUOXMAFIF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|