C15H17ClN4O4 — CID 139678345
N-[1-(2-chlorobenzoyl)-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide (PubChem CID 139678345) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is N-[1-(2-chlorobenzoyl)-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-(2-chlorobenzoyl)-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678345 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[1-(2-chlorobenzoyl)-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
| SMILES | O=C(c1ccccc1Cl)N1CCN(CC2CCOC2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C15H17ClN4O4/c16-13-4-2-1-3-12(13)14(21)19-7-6-18(15(19)17-20(22)23)9-11-5-8-24-10-11/h1-4,11H,5-10H2 |
| InChIKey | GDNXLLISRAHHDQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|